C19H19ClN2O3 — CID 29148265
N-[(Z)-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine (PubChem CID 29148265) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is N-[(Z)-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine.
| Compound Name | N-[(Z)-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 29148265 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-[(Z)-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine |
| SMILES | C#CCOc1c(Cl)cc(/C=N\NCc2ccccc2OC)cc1OC |
| InChI | InChI=1S/C19H19ClN2O3/c1-4-9-25-19-16(20)10-14(11-18(19)24-3)12-21-22-13-15-7-5-6-8-17(15)23-2/h1,5-8,10-12,22H,9,13H2,2-3H3/b21-12- |
| InChIKey | AEGQQINKPYOYJM-MTJSOVHGSA-N |
| XLogP | 3.49 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|