C19H21IN2O5 — CID 29148441
2-[2-ethoxy-6-iodo-4-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 29148441) has the molecular formula C19H21IN2O5 and a molecular weight of 484.29 g/mol. Its IUPAC name is 2-[2-ethoxy-6-iodo-4-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-6-iodo-4-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 29148441 |
| Molecular Formula | C19H21IN2O5 |
| Molecular Weight | 484.29 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 2-[2-ethoxy-6-iodo-4-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(/C=N\NCc2ccccc2OC)cc(I)c1OCC(=O)O |
| InChI | InChI=1S/C19H21IN2O5/c1-3-26-17-9-13(8-15(20)19(17)27-12-18(23)24)10-21-22-11-14-6-4-5-7-16(14)25-2/h4-10,22H,3,11-12H2,1-2H3,(H,23,24)/b21-10- |
| InChIKey | AYYDVULVSCQSKB-FBHDLOMBSA-N |
| XLogP | 3.29 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|