C23H22IN3O5 — CID 17245653
N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1-(2-methoxyphenyl)methanamine (PubChem CID 17245653) has the molecular formula C23H22IN3O5 and a molecular weight of 547.35 g/mol. Its IUPAC name is N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1-(2-methoxyphenyl)methanamine.
| Compound Name | N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1-(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 17245653 |
| Molecular Formula | C23H22IN3O5 |
| Molecular Weight | 547.35 g/mol |
| Exact Mass | 547.06 |
| IUPAC Name | N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1-(2-methoxyphenyl)methanamine |
| SMILES | COc1ccccc1CN/N=C/c1cc(I)c(OCc2ccc([N+](=O)[O-])cc2)c(OC)c1 |
| InChI | InChI=1S/C23H22IN3O5/c1-30-21-6-4-3-5-18(21)14-26-25-13-17-11-20(24)23(22(12-17)31-2)32-15-16-7-9-19(10-8-16)27(28)29/h3-13,26H,14-15H2,1-2H3/b25-13+ |
| InChIKey | RPCMEXQOGOCDHR-DHRITJCHSA-N |
| XLogP | 4.92 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|