C24H25BrN2O3 — CID 29147588
N-[(Z)-(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine (PubChem CID 29147588) has the molecular formula C24H25BrN2O3 and a molecular weight of 469.38 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine.
| Compound Name | N-[(Z)-(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 29147588 |
| Molecular Formula | C24H25BrN2O3 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | N-[(Z)-(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine |
| SMILES | CCOc1cc(/C=N\NCc2ccccc2OC)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H25BrN2O3/c1-3-29-23-14-19(15-26-27-16-20-11-7-8-12-22(20)28-2)13-21(25)24(23)30-17-18-9-5-4-6-10-18/h4-15,27H,3,16-17H2,1-2H3/b26-15- |
| InChIKey | XHXCOMPCEAECBV-YSMPRRRNSA-N |
| XLogP | 5.56 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|