C23H22BrClN2O3 — CID 17245640
N-[(E)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-1-(2-methoxyphenyl)methanamine (PubChem CID 17245640) has the molecular formula C23H22BrClN2O3 and a molecular weight of 489.80 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-1-(2-methoxyphenyl)methanamine.
| Compound Name | N-[(E)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-1-(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 17245640 |
| Molecular Formula | C23H22BrClN2O3 |
| Molecular Weight | 489.80 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-1-(2-methoxyphenyl)methanamine |
| SMILES | COc1ccccc1CN/N=C/c1cc(Br)c(OCc2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H22BrClN2O3/c1-28-21-6-4-3-5-18(21)14-27-26-13-17-11-20(24)23(22(12-17)29-2)30-15-16-7-9-19(25)10-8-16/h3-13,27H,14-15H2,1-2H3/b26-13+ |
| InChIKey | JTKRXWCKFJMDPZ-LGJNPRDNSA-N |
| XLogP | 5.82 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.80 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|