C25H24BrN3O3 — CID 29148432
4-[[2-bromo-6-ethoxy-4-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 29148432) has the molecular formula C25H24BrN3O3 and a molecular weight of 494.39 g/mol. Its IUPAC name is 4-[[2-bromo-6-ethoxy-4-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 4-[[2-bromo-6-ethoxy-4-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 29148432 |
| Molecular Formula | C25H24BrN3O3 |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 4-[[2-bromo-6-ethoxy-4-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | CCOc1cc(/C=N\NCc2ccccc2OC)cc(Br)c1OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C25H24BrN3O3/c1-3-31-24-13-20(15-28-29-16-21-6-4-5-7-23(21)30-2)12-22(26)25(24)32-17-19-10-8-18(14-27)9-11-19/h4-13,15,29H,3,16-17H2,1-2H3/b28-15- |
| InChIKey | RZSOMZBTVNUYCH-MBTHVWNTSA-N |
| XLogP | 5.43 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|