C26H22Br2N2O2 — CID 17245610
N-[(E)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-(2-methoxyphenyl)methanamine (PubChem CID 17245610) has the molecular formula C26H22Br2N2O2 and a molecular weight of 554.28 g/mol. Its IUPAC name is N-[(E)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-(2-methoxyphenyl)methanamine.
| Compound Name | N-[(E)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 17245610 |
| Molecular Formula | C26H22Br2N2O2 |
| Molecular Weight | 554.28 g/mol |
| Exact Mass | 552.00 |
| IUPAC Name | N-[(E)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-(2-methoxyphenyl)methanamine |
| SMILES | COc1ccccc1CN/N=C/c1cc(Br)c(OCc2cccc3ccccc23)c(Br)c1 |
| InChI | InChI=1S/C26H22Br2N2O2/c1-31-25-12-5-3-8-20(25)16-30-29-15-18-13-23(27)26(24(28)14-18)32-17-21-10-6-9-19-7-2-4-11-22(19)21/h2-15,30H,16-17H2,1H3/b29-15+ |
| InChIKey | KLMKUKWWJFBKKV-WKULSOCRSA-N |
| XLogP | 7.08 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.28 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|