C25H18Br2Cl2N2O — CID 98050135
N-[(Z)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine (PubChem CID 98050135) has the molecular formula C25H18Br2Cl2N2O and a molecular weight of 593.15 g/mol. Its IUPAC name is N-[(Z)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine.
| Compound Name | N-[(Z)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine |
|---|---|
| PubChem CID | 98050135 |
| Molecular Formula | C25H18Br2Cl2N2O |
| Molecular Weight | 593.15 g/mol |
| Exact Mass | 589.92 |
| IUPAC Name | N-[(Z)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine |
| SMILES | Clc1cccc(Cl)c1CN/N=C\c1cc(Br)c(OCc2cccc3ccccc23)c(Br)c1 |
| InChI | InChI=1S/C25H18Br2Cl2N2O/c26-21-11-16(13-30-31-14-20-23(28)9-4-10-24(20)29)12-22(27)25(21)32-15-18-7-3-6-17-5-1-2-8-19(17)18/h1-13,31H,14-15H2/b30-13- |
| InChIKey | TYMCNGSRZRDFGD-YNFMAFFXSA-N |
| XLogP | 8.37 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.15 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|