C21H14Br3ClN2O2 — CID 17245248
2-bromo-N-[(E)-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]benzamide (PubChem CID 17245248) has the molecular formula C21H14Br3ClN2O2 and a molecular weight of 601.52 g/mol. Its IUPAC name is 2-bromo-N-[(E)-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(E)-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 17245248 |
| Molecular Formula | C21H14Br3ClN2O2 |
| Molecular Weight | 601.52 g/mol |
| Exact Mass | 597.83 |
| IUPAC Name | 2-bromo-N-[(E)-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1cc(Br)c(OCc2ccccc2Cl)c(Br)c1)c1ccccc1Br |
| InChI | InChI=1S/C21H14Br3ClN2O2/c22-16-7-3-2-6-15(16)21(28)27-26-11-13-9-17(23)20(18(24)10-13)29-12-14-5-1-4-8-19(14)25/h1-11H,12H2,(H,27,28)/b26-11+ |
| InChIKey | DASRSJLVANNUQJ-KBKYJPHKSA-N |
| XLogP | 6.97 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.52 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|