C29H23BrClFN2O4 — CID 19657377
N-[(E)-[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[(2-chlorophenyl)methoxy]benzamide (PubChem CID 19657377) has the molecular formula C29H23BrClFN2O4 and a molecular weight of 597.87 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[(2-chlorophenyl)methoxy]benzamide.
| Compound Name | N-[(E)-[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[(2-chlorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 19657377 |
| Molecular Formula | C29H23BrClFN2O4 |
| Molecular Weight | 597.87 g/mol |
| Exact Mass | 596.05 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[(2-chlorophenyl)methoxy]benzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccccc2OCc2ccccc2Cl)cc(Br)c1OCc1ccccc1F |
| InChI | InChI=1S/C29H23BrClFN2O4/c1-36-27-15-19(14-23(30)28(27)38-18-21-9-3-6-12-25(21)32)16-33-34-29(35)22-10-4-7-13-26(22)37-17-20-8-2-5-11-24(20)31/h2-16H,17-18H2,1H3,(H,34,35)/b33-16+ |
| InChIKey | MEUFLVPMVXADDV-MHDJOFBISA-N |
| XLogP | 7.17 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.87 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|