C29H22Cl2FIN2O4 — CID 19657624
2-[(2,4-dichlorophenyl)methoxy]-N-[(E)-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]benzamide (PubChem CID 19657624) has the molecular formula C29H22Cl2FIN2O4 and a molecular weight of 679.31 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methoxy]-N-[(E)-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]benzamide.
| Compound Name | 2-[(2,4-dichlorophenyl)methoxy]-N-[(E)-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 19657624 |
| Molecular Formula | C29H22Cl2FIN2O4 |
| Molecular Weight | 679.31 g/mol |
| Exact Mass | 678.00 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methoxy]-N-[(E)-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]benzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccccc2OCc2ccc(Cl)cc2Cl)cc(I)c1OCc1ccccc1F |
| InChI | InChI=1S/C29H22Cl2FIN2O4/c1-37-27-13-18(12-25(33)28(27)39-17-20-6-2-4-8-24(20)32)15-34-35-29(36)22-7-3-5-9-26(22)38-16-19-10-11-21(30)14-23(19)31/h2-15H,16-17H2,1H3,(H,35,36)/b34-15+ |
| InChIKey | ZYXUZTCUPBPBHL-PUHLOBNQSA-N |
| XLogP | 7.67 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.31 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|