C25H21Cl2FIN3O4 — CID 3373238
N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(2-fluorophenyl)butanediamide (PubChem CID 3373238) has the molecular formula C25H21Cl2FIN3O4 and a molecular weight of 644.27 g/mol. Its IUPAC name is N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(2-fluorophenyl)butanediamide.
| Compound Name | N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(2-fluorophenyl)butanediamide |
|---|---|
| PubChem CID | 3373238 |
| Molecular Formula | C25H21Cl2FIN3O4 |
| Molecular Weight | 644.27 g/mol |
| Exact Mass | 642.99 |
| IUPAC Name | N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(2-fluorophenyl)butanediamide |
| SMILES | COc1cc(C=NNC(=O)CCC(=O)Nc2ccccc2F)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H21Cl2FIN3O4/c1-35-22-11-15(10-20(29)25(22)36-14-16-6-7-17(26)12-18(16)27)13-30-32-24(34)9-8-23(33)31-21-5-3-2-4-19(21)28/h2-7,10-13H,8-9,14H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | QVNSUPICPDFISU-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.27 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|