C28H28Cl2IN3O4 — CID 3376367
N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-N-(2,5-dimethylphenyl)butanediamide (PubChem CID 3376367) has the molecular formula C28H28Cl2IN3O4 and a molecular weight of 668.36 g/mol. Its IUPAC name is N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-N-(2,5-dimethylphenyl)butanediamide.
| Compound Name | N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-N-(2,5-dimethylphenyl)butanediamide |
|---|---|
| PubChem CID | 3376367 |
| Molecular Formula | C28H28Cl2IN3O4 |
| Molecular Weight | 668.36 g/mol |
| Exact Mass | 667.05 |
| IUPAC Name | N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-N-(2,5-dimethylphenyl)butanediamide |
| SMILES | CCOc1cc(C=NNC(=O)CCC(=O)Nc2cc(C)ccc2C)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H28Cl2IN3O4/c1-4-37-25-13-19(12-23(31)28(25)38-16-20-7-8-21(29)14-22(20)30)15-32-34-27(36)10-9-26(35)33-24-11-17(2)5-6-18(24)3/h5-8,11-15H,4,9-10,16H2,1-3H3,(H,33,35)(H,34,36) |
| InChIKey | FRKASUIFTYULHR-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.36 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|