C24H22Cl2INO2 — CID 126217711
1-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-N-(2,5-dimethylphenyl)methanimine (PubChem CID 126217711) has the molecular formula C24H22Cl2INO2 and a molecular weight of 554.26 g/mol. Its IUPAC name is 1-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-N-(2,5-dimethylphenyl)methanimine.
| Compound Name | 1-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-N-(2,5-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 126217711 |
| Molecular Formula | C24H22Cl2INO2 |
| Molecular Weight | 554.26 g/mol |
| Exact Mass | 553.01 |
| IUPAC Name | 1-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-N-(2,5-dimethylphenyl)methanimine |
| SMILES | CCOc1cc(/C=N/c2cc(C)ccc2C)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H22Cl2INO2/c1-4-29-23-11-17(13-28-22-9-15(2)5-6-16(22)3)10-21(27)24(23)30-14-18-7-8-19(25)12-20(18)26/h5-13H,4,14H2,1-3H3/b28-13+ |
| InChIKey | NWSFSFKODQQHMC-XODNFHPESA-N |
| XLogP | 7.94 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.26 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|