C19H22INO2 — CID 126220598
1-(3,4-diethoxy-5-iodophenyl)-N-(2,4-dimethylphenyl)methanimine (PubChem CID 126220598) has the molecular formula C19H22INO2 and a molecular weight of 423.29 g/mol. Its IUPAC name is 1-(3,4-diethoxy-5-iodophenyl)-N-(2,4-dimethylphenyl)methanimine.
| Compound Name | 1-(3,4-diethoxy-5-iodophenyl)-N-(2,4-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 126220598 |
| Molecular Formula | C19H22INO2 |
| Molecular Weight | 423.29 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 1-(3,4-diethoxy-5-iodophenyl)-N-(2,4-dimethylphenyl)methanimine |
| SMILES | CCOc1cc(/C=N/c2ccc(C)cc2C)cc(I)c1OCC |
| InChI | InChI=1S/C19H22INO2/c1-5-22-18-11-15(10-16(20)19(18)23-6-2)12-21-17-8-7-13(3)9-14(17)4/h7-12H,5-6H2,1-4H3/b21-12+ |
| InChIKey | XFWHTTLUSBBTOR-CIAFOILYSA-N |
| XLogP | 5.46 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.29 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|