C25H26INO2 — CID 126224516
N-(3,4-dimethylphenyl)-1-[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methanimine (PubChem CID 126224516) has the molecular formula C25H26INO2 and a molecular weight of 499.39 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-1-[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methanimine.
| Compound Name | N-(3,4-dimethylphenyl)-1-[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 126224516 |
| Molecular Formula | C25H26INO2 |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | N-(3,4-dimethylphenyl)-1-[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methanimine |
| SMILES | CCOc1cc(/C=N/c2ccc(C)c(C)c2)cc(I)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C25H26INO2/c1-5-28-24-14-21(15-27-22-11-8-18(3)19(4)12-22)13-23(26)25(24)29-16-20-9-6-17(2)7-10-20/h6-15H,5,16H2,1-4H3/b27-15+ |
| InChIKey | HXZBKWFNQVEJCJ-JFLMPSFJSA-N |
| XLogP | 6.94 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|