C24H23FINO3 — CID 126223346
1-[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]-N-(4-ethoxyphenyl)methanimine (PubChem CID 126223346) has the molecular formula C24H23FINO3 and a molecular weight of 519.35 g/mol. Its IUPAC name is 1-[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]-N-(4-ethoxyphenyl)methanimine.
| Compound Name | 1-[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]-N-(4-ethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126223346 |
| Molecular Formula | C24H23FINO3 |
| Molecular Weight | 519.35 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | 1-[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]-N-(4-ethoxyphenyl)methanimine |
| SMILES | CCOc1ccc(/N=C/c2cc(I)c(OCc3ccc(F)cc3)c(OCC)c2)cc1 |
| InChI | InChI=1S/C24H23FINO3/c1-3-28-21-11-9-20(10-12-21)27-15-18-13-22(26)24(23(14-18)29-4-2)30-16-17-5-7-19(25)8-6-17/h5-15H,3-4,16H2,1-2H3/b27-15+ |
| InChIKey | SNZPRBOEBNFKSK-JFLMPSFJSA-N |
| XLogP | 6.56 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.35 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|