C19H21FIN3O2S — CID 126378055
1-[(Z)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylideneamino]-3-ethylthiourea (PubChem CID 126378055) has the molecular formula C19H21FIN3O2S and a molecular weight of 501.37 g/mol. Its IUPAC name is 1-[(Z)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[(Z)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 126378055 |
| Molecular Formula | C19H21FIN3O2S |
| Molecular Weight | 501.37 g/mol |
| Exact Mass | 501.04 |
| IUPAC Name | 1-[(Z)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)N/N=C\c1cc(I)c(OCc2ccc(F)cc2)c(OCC)c1 |
| InChI | InChI=1S/C19H21FIN3O2S/c1-3-22-19(27)24-23-11-14-9-16(21)18(17(10-14)25-4-2)26-12-13-5-7-15(20)8-6-13/h5-11H,3-4,12H2,1-2H3,(H2,22,24,27)/b23-11- |
| InChIKey | STVFGLLAWSMUJK-KSEXSDGBSA-N |
| XLogP | 4.23 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|