C17H17ClIN3O2S — CID 5026063
[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]thiourea (PubChem CID 5026063) has the molecular formula C17H17ClIN3O2S and a molecular weight of 489.77 g/mol. Its IUPAC name is [[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]thiourea.
| Compound Name | [[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 5026063 |
| Molecular Formula | C17H17ClIN3O2S |
| Molecular Weight | 489.77 g/mol |
| Exact Mass | 488.98 |
| IUPAC Name | [[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]thiourea |
| SMILES | CCOc1cc(C=NNC(N)=S)cc(I)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClIN3O2S/c1-2-23-15-8-12(9-21-22-17(20)25)7-14(19)16(15)24-10-11-3-5-13(18)6-4-11/h3-9H,2,10H2,1H3,(H3,20,22,25) |
| InChIKey | JHFNCJJAUDGRGP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.77 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|