C16H15ClINO3 — CID 91682374
4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodobenzamide (PubChem CID 91682374) has the molecular formula C16H15ClINO3 and a molecular weight of 431.66 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodobenzamide.
| Compound Name | 4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodobenzamide |
|---|---|
| PubChem CID | 91682374 |
| Molecular Formula | C16H15ClINO3 |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | 4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodobenzamide |
| SMILES | CCOc1cc(C(N)=O)cc(I)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClINO3/c1-2-21-14-8-11(16(19)20)7-13(18)15(14)22-9-10-3-5-12(17)6-4-10/h3-8H,2,9H2,1H3,(H2,19,20) |
| InChIKey | KPEBHGPTZNDGTH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|