C16H14ClIN4O2 — CID 132592973
5-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-2H-tetrazole (PubChem CID 132592973) has the molecular formula C16H14ClIN4O2 and a molecular weight of 456.67 g/mol. Its IUPAC name is 5-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-2H-tetrazole.
| Compound Name | 5-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 132592973 |
| Molecular Formula | C16H14ClIN4O2 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | 5-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-2H-tetrazole |
| SMILES | CCOc1cc(-c2nn[nH]n2)cc(I)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClIN4O2/c1-2-23-14-8-11(16-19-21-22-20-16)7-13(18)15(14)24-9-10-3-5-12(17)6-4-10/h3-8H,2,9H2,1H3,(H,19,20,21,22) |
| InChIKey | AXFILMKGVOMYMA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|