C27H28ClIN2O5 — CID 126325701
N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-3,4-diethoxybenzamide (PubChem CID 126325701) has the molecular formula C27H28ClIN2O5 and a molecular weight of 622.89 g/mol. Its IUPAC name is N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-3,4-diethoxybenzamide.
| Compound Name | N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 126325701 |
| Molecular Formula | C27H28ClIN2O5 |
| Molecular Weight | 622.89 g/mol |
| Exact Mass | 622.07 |
| IUPAC Name | N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2cc(I)c(OCc3ccc(Cl)cc3)c(OCC)c2)cc1OCC |
| InChI | InChI=1S/C27H28ClIN2O5/c1-4-33-23-12-9-20(15-24(23)34-5-2)27(32)31-30-16-19-13-22(29)26(25(14-19)35-6-3)36-17-18-7-10-21(28)11-8-18/h7-16H,4-6,17H2,1-3H3,(H,31,32)/b30-16+ |
| InChIKey | IFMRIWOZISMJCC-OKCVXOCRSA-N |
| XLogP | 6.48 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.89 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|