C16H13Cl2O4- — CID 8706924
3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxybenzoate (PubChem CID 8706924) has the molecular formula C16H13Cl2O4- and a molecular weight of 340.18 g/mol. Its IUPAC name is 3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxybenzoate.
| Compound Name | 3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxybenzoate |
|---|---|
| PubChem CID | 8706924 |
| Molecular Formula | C16H13Cl2O4- |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxybenzoate |
| SMILES | CCOc1cc(C(=O)[O-])cc(Cl)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14Cl2O4/c1-2-21-14-8-11(16(19)20)7-13(18)15(14)22-9-10-3-5-12(17)6-4-10/h3-8H,2,9H2,1H3,(H,19,20)/p-1 |
| InChIKey | NWLIZYAECDDHKR-UHFFFAOYSA-M |
| XLogP | 3.33 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |