C16H17Cl2NO2 — CID 20988973
[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methanamine (PubChem CID 20988973) has the molecular formula C16H17Cl2NO2 and a molecular weight of 326.22 g/mol. Its IUPAC name is [3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methanamine.
| Compound Name | [3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methanamine |
|---|---|
| PubChem CID | 20988973 |
| Molecular Formula | C16H17Cl2NO2 |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | [3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methanamine |
| SMILES | CCOc1cc(CN)cc(Cl)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17Cl2NO2/c1-2-20-15-8-12(9-19)7-14(18)16(15)21-10-11-3-5-13(17)6-4-11/h3-8H,2,9-10,19H2,1H3 |
| InChIKey | HVTQLLIFNWOZBG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |