C17H18Cl3NO3 — CID 22679990
[3-chloro-4-[2-(2,5-dichlorophenoxy)ethoxy]-5-ethoxyphenyl]methanamine (PubChem CID 22679990) has the molecular formula C17H18Cl3NO3 and a molecular weight of 390.69 g/mol. Its IUPAC name is [3-chloro-4-[2-(2,5-dichlorophenoxy)ethoxy]-5-ethoxyphenyl]methanamine.
| Compound Name | [3-chloro-4-[2-(2,5-dichlorophenoxy)ethoxy]-5-ethoxyphenyl]methanamine |
|---|---|
| PubChem CID | 22679990 |
| Molecular Formula | C17H18Cl3NO3 |
| Molecular Weight | 390.69 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | [3-chloro-4-[2-(2,5-dichlorophenoxy)ethoxy]-5-ethoxyphenyl]methanamine |
| SMILES | CCOc1cc(CN)cc(Cl)c1OCCOc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H18Cl3NO3/c1-2-22-16-8-11(10-21)7-14(20)17(16)24-6-5-23-15-9-12(18)3-4-13(15)19/h3-4,7-9H,2,5-6,10,21H2,1H3 |
| InChIKey | VDGKWUNDBNZEPM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.69 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|