C11H14Cl2O2 — CID 79005556
1,4-dichloro-2-(3-ethoxypropoxy)benzene (PubChem CID 79005556) has the molecular formula C11H14Cl2O2 and a molecular weight of 249.14 g/mol. Its IUPAC name is 1,4-dichloro-2-(3-ethoxypropoxy)benzene.
| Compound Name | 1,4-dichloro-2-(3-ethoxypropoxy)benzene |
|---|---|
| PubChem CID | 79005556 |
| Molecular Formula | C11H14Cl2O2 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 1,4-dichloro-2-(3-ethoxypropoxy)benzene |
| SMILES | CCOCCCOc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H14Cl2O2/c1-2-14-6-3-7-15-11-8-9(12)4-5-10(11)13/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | TWNUSQRRLDGMHN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|