C11H16ClNO4S — CID 65180427
5-chloro-2-(3-ethoxypropoxy)benzenesulfonamide (PubChem CID 65180427) has the molecular formula C11H16ClNO4S and a molecular weight of 293.77 g/mol. Its IUPAC name is 5-chloro-2-(3-ethoxypropoxy)benzenesulfonamide.
| Compound Name | 5-chloro-2-(3-ethoxypropoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 65180427 |
| Molecular Formula | C11H16ClNO4S |
| Molecular Weight | 293.77 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 5-chloro-2-(3-ethoxypropoxy)benzenesulfonamide |
| SMILES | CCOCCCOc1ccc(Cl)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H16ClNO4S/c1-2-16-6-3-7-17-10-5-4-9(12)8-11(10)18(13,14)15/h4-5,8H,2-3,6-7H2,1H3,(H2,13,14,15) |
| InChIKey | XXZFNQMWCAMPNC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.77 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|