C9H9ClF3NO3S — CID 64567349
5-chloro-2-(3,3,3-trifluoropropoxy)benzenesulfonamide (PubChem CID 64567349) has the molecular formula C9H9ClF3NO3S and a molecular weight of 303.69 g/mol. Its IUPAC name is 5-chloro-2-(3,3,3-trifluoropropoxy)benzenesulfonamide.
| Compound Name | 5-chloro-2-(3,3,3-trifluoropropoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 64567349 |
| Molecular Formula | C9H9ClF3NO3S |
| Molecular Weight | 303.69 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 5-chloro-2-(3,3,3-trifluoropropoxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Cl)ccc1OCCC(F)(F)F |
| InChI | InChI=1S/C9H9ClF3NO3S/c10-6-1-2-7(8(5-6)18(14,15)16)17-4-3-9(11,12)13/h1-2,5H,3-4H2,(H2,14,15,16) |
| InChIKey | XSDNEZTXQCQFGA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.69 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |