C9H10ClNO5S — CID 70527537
methyl 2-(4-chloro-2-sulfamoylphenoxy)acetate (PubChem CID 70527537) has the molecular formula C9H10ClNO5S and a molecular weight of 279.70 g/mol. Its IUPAC name is methyl 2-(4-chloro-2-sulfamoylphenoxy)acetate.
| Compound Name | methyl 2-(4-chloro-2-sulfamoylphenoxy)acetate |
|---|---|
| PubChem CID | 70527537 |
| Molecular Formula | C9H10ClNO5S |
| Molecular Weight | 279.70 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | methyl 2-(4-chloro-2-sulfamoylphenoxy)acetate |
| SMILES | COC(=O)COc1ccc(Cl)cc1S(N)(=O)=O |
| InChI | InChI=1S/C9H10ClNO5S/c1-15-9(12)5-16-7-3-2-6(10)4-8(7)17(11,13)14/h2-4H,5H2,1H3,(H2,11,13,14) |
| InChIKey | PIBHUGFRIARRAJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.70 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |