methyl 2-(2-sulfamoylphenoxy)acetate

C9H11NO5S — CID 15702321

IUPACmethyl 2-(2-sulfamoylphenoxy)acetate
SMILESCOC(=O)COc1ccccc1S(N)(=O)=O
InChIInChI=1S/C9H11NO5S/c1-14-9(11)6-15-7-4-2-3-5-8(7)16(10,12)13/h2-5H,6H2,1H3,(H2,10,12,13)
InChIKeyOJLXCYZNLNGRJU-UHFFFAOYSA-N
MW245.26 g/mol
LogP-0.11
Rot. Bonds4

About methyl 2-(2-sulfamoylphenoxy)acetate

methyl 2-(2-sulfamoylphenoxy)acetate (PubChem CID 15702321) has the molecular formula C9H11NO5S and a molecular weight of 245.26 g/mol. Its IUPAC name is methyl 2-(2-sulfamoylphenoxy)acetate.

Molecular Properties

Compound Namemethyl 2-(2-sulfamoylphenoxy)acetate
PubChem CID15702321
Molecular FormulaC9H11NO5S
Molecular Weight245.26 g/mol
Exact Mass245.04
IUPAC Namemethyl 2-(2-sulfamoylphenoxy)acetate
SMILESCOC(=O)COc1ccccc1S(N)(=O)=O
InChIInChI=1S/C9H11NO5S/c1-14-9(11)6-15-7-4-2-3-5-8(7)16(10,12)13/h2-5H,6H2,1H3,(H2,10,12,13)
InChIKeyOJLXCYZNLNGRJU-UHFFFAOYSA-N
XLogP-0.11
TPSA95.69 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.26
LogP ≤ 5-0.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-(2-sulfamoylphenoxy)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2-sulfamoylphenoxy)acetate?
The IUPAC name of methyl 2-(2-sulfamoylphenoxy)acetate (CID 15702321) is methyl 2-(2-sulfamoylphenoxy)acetate.
What is the SMILES notation for methyl 2-(2-sulfamoylphenoxy)acetate?
The canonical SMILES for methyl 2-(2-sulfamoylphenoxy)acetate is COC(=O)COc1ccccc1S(N)(=O)=O.
What is the InChIKey of methyl 2-(2-sulfamoylphenoxy)acetate?
The InChIKey is OJLXCYZNLNGRJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO5S/c1-14-9(11)6-15-7-4-2-3-5-8(7)16(10,12)13/h2-5H,6H2,1H3,(H2,10,12,13).
What are the key properties of methyl 2-(2-sulfamoylphenoxy)acetate?
methyl 2-(2-sulfamoylphenoxy)acetate has a molecular weight of 245.26 g/mol, XLogP of -0.11, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-sulfamoylphenoxy)acetate is sourced from PubChem (CID 15702321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).