C11H14F3NO4S — CID 61490332
5-methyl-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzenesulfonamide (PubChem CID 61490332) has the molecular formula C11H14F3NO4S and a molecular weight of 313.30 g/mol. Its IUPAC name is 5-methyl-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzenesulfonamide.
| Compound Name | 5-methyl-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 61490332 |
| Molecular Formula | C11H14F3NO4S |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 5-methyl-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzenesulfonamide |
| SMILES | Cc1ccc(OCCOCC(F)(F)F)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H14F3NO4S/c1-8-2-3-9(10(6-8)20(15,16)17)19-5-4-18-7-11(12,13)14/h2-3,6H,4-5,7H2,1H3,(H2,15,16,17) |
| InChIKey | GKNJDZIJHKIWEJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|