C11H18N2O5S — CID 104560023
5-amino-2-[2-(2-methoxyethoxy)ethoxy]benzenesulfonamide (PubChem CID 104560023) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is 5-amino-2-[2-(2-methoxyethoxy)ethoxy]benzenesulfonamide.
| Compound Name | 5-amino-2-[2-(2-methoxyethoxy)ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 104560023 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 5-amino-2-[2-(2-methoxyethoxy)ethoxy]benzenesulfonamide |
| SMILES | COCCOCCOc1ccc(N)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H18N2O5S/c1-16-4-5-17-6-7-18-10-3-2-9(12)8-11(10)19(13,14)15/h2-3,8H,4-7,12H2,1H3,(H2,13,14,15) |
| InChIKey | WHCPHDSYYIXXJN-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|