C12H20N2O5S — CID 104559989
5-amino-3-[2-(2-methoxyethoxy)ethoxy]-2-methylbenzenesulfonamide (PubChem CID 104559989) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is 5-amino-3-[2-(2-methoxyethoxy)ethoxy]-2-methylbenzenesulfonamide.
| Compound Name | 5-amino-3-[2-(2-methoxyethoxy)ethoxy]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 104559989 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 5-amino-3-[2-(2-methoxyethoxy)ethoxy]-2-methylbenzenesulfonamide |
| SMILES | COCCOCCOc1cc(N)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C12H20N2O5S/c1-9-11(19-6-5-18-4-3-17-2)7-10(13)8-12(9)20(14,15)16/h7-8H,3-6,13H2,1-2H3,(H2,14,15,16) |
| InChIKey | QMTXNTHQISSBGD-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|