C14H23NO5S — CID 103180943
4-[2-(3-methoxypropoxy)ethoxy]-2,3-dimethylbenzenesulfonamide (PubChem CID 103180943) has the molecular formula C14H23NO5S and a molecular weight of 317.41 g/mol. Its IUPAC name is 4-[2-(3-methoxypropoxy)ethoxy]-2,3-dimethylbenzenesulfonamide.
| Compound Name | 4-[2-(3-methoxypropoxy)ethoxy]-2,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 103180943 |
| Molecular Formula | C14H23NO5S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 4-[2-(3-methoxypropoxy)ethoxy]-2,3-dimethylbenzenesulfonamide |
| SMILES | COCCCOCCOc1ccc(S(N)(=O)=O)c(C)c1C |
| InChI | InChI=1S/C14H23NO5S/c1-11-12(2)14(21(15,16)17)6-5-13(11)20-10-9-19-8-4-7-18-3/h5-6H,4,7-10H2,1-3H3,(H2,15,16,17) |
| InChIKey | KTTRRKGYHLCVDW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|