C11H15NO3S — CID 82922074
2,3-dimethyl-4-prop-2-enoxybenzenesulfonamide (PubChem CID 82922074) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 2,3-dimethyl-4-prop-2-enoxybenzenesulfonamide.
| Compound Name | 2,3-dimethyl-4-prop-2-enoxybenzenesulfonamide |
|---|---|
| PubChem CID | 82922074 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 2,3-dimethyl-4-prop-2-enoxybenzenesulfonamide |
| SMILES | C=CCOc1ccc(S(N)(=O)=O)c(C)c1C |
| InChI | InChI=1S/C11H15NO3S/c1-4-7-15-10-5-6-11(16(12,13)14)9(3)8(10)2/h4-6H,1,7H2,2-3H3,(H2,12,13,14) |
| InChIKey | SKQOFCKFCBJLMN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|