C12H17NO5S — CID 43342347
4-(2,3-dimethyl-4-sulfamoylphenoxy)butanoic acid (PubChem CID 43342347) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is 4-(2,3-dimethyl-4-sulfamoylphenoxy)butanoic acid.
| Compound Name | 4-(2,3-dimethyl-4-sulfamoylphenoxy)butanoic acid |
|---|---|
| PubChem CID | 43342347 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 4-(2,3-dimethyl-4-sulfamoylphenoxy)butanoic acid |
| SMILES | Cc1c(OCCCC(=O)O)ccc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C12H17NO5S/c1-8-9(2)11(19(13,16)17)6-5-10(8)18-7-3-4-12(14)15/h5-6H,3-4,7H2,1-2H3,(H,14,15)(H2,13,16,17) |
| InChIKey | LFEYVRBITBVWJZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|