C10H9Cl3O5S — CID 43247032
4-(2,3-dichloro-4-chlorosulfonylphenoxy)butanoic acid (PubChem CID 43247032) has the molecular formula C10H9Cl3O5S and a molecular weight of 347.60 g/mol. Its IUPAC name is 4-(2,3-dichloro-4-chlorosulfonylphenoxy)butanoic acid.
| Compound Name | 4-(2,3-dichloro-4-chlorosulfonylphenoxy)butanoic acid |
|---|---|
| PubChem CID | 43247032 |
| Molecular Formula | C10H9Cl3O5S |
| Molecular Weight | 347.60 g/mol |
| Exact Mass | 345.92 |
| IUPAC Name | 4-(2,3-dichloro-4-chlorosulfonylphenoxy)butanoic acid |
| SMILES | O=C(O)CCCOc1ccc(S(=O)(=O)Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C10H9Cl3O5S/c11-9-6(18-5-1-2-8(14)15)3-4-7(10(9)12)19(13,16)17/h3-4H,1-2,5H2,(H,14,15) |
| InChIKey | SLJVQOSWNIKFOT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.60 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|