2,3-dichloro-4-(2,2-difluoroethoxy)benzenesulfonyl chloride

C8H5Cl3F2O3S — CID 60922522

IUPAC2,3-dichloro-4-(2,2-difluoroethoxy)benzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc(OCC(F)F)c(Cl)c1Cl
InChIInChI=1S/C8H5Cl3F2O3S/c9-7-4(16-3-6(12)13)1-2-5(8(7)10)17(11,14)15/h1-2,6H,3H2
InChIKeyWQVINRKETPSKIC-UHFFFAOYSA-N
MW325.55 g/mol
LogP3.56
Rot. Bonds4

About 2,3-dichloro-4-(2,2-difluoroethoxy)benzenesulfonyl chloride

2,3-dichloro-4-(2,2-difluoroethoxy)benzenesulfonyl chloride (PubChem CID 60922522) has the molecular formula C8H5Cl3F2O3S and a molecular weight of 325.55 g/mol. Its IUPAC name is 2,3-dichloro-4-(2,2-difluoroethoxy)benzenesulfonyl chloride.

Molecular Properties

Compound Name2,3-dichloro-4-(2,2-difluoroethoxy)benzenesulfonyl chloride
PubChem CID60922522
Molecular FormulaC8H5Cl3F2O3S
Molecular Weight325.55 g/mol
Exact Mass323.90
IUPAC Name2,3-dichloro-4-(2,2-difluoroethoxy)benzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc(OCC(F)F)c(Cl)c1Cl
InChIInChI=1S/C8H5Cl3F2O3S/c9-7-4(16-3-6(12)13)1-2-5(8(7)10)17(11,14)15/h1-2,6H,3H2
InChIKeyWQVINRKETPSKIC-UHFFFAOYSA-N
XLogP3.56
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.55
LogP ≤ 53.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 2,3-dichloro-4-(2,2-difluoroethoxy)benzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dichloro-4-(2,2-difluoroethoxy)benzenesulfonyl chloride?
The IUPAC name of 2,3-dichloro-4-(2,2-difluoroethoxy)benzenesulfonyl chloride (CID 60922522) is 2,3-dichloro-4-(2,2-difluoroethoxy)benzenesulfonyl chloride.
What is the SMILES notation for 2,3-dichloro-4-(2,2-difluoroethoxy)benzenesulfonyl chloride?
The canonical SMILES for 2,3-dichloro-4-(2,2-difluoroethoxy)benzenesulfonyl chloride is O=S(=O)(Cl)c1ccc(OCC(F)F)c(Cl)c1Cl.
What is the InChIKey of 2,3-dichloro-4-(2,2-difluoroethoxy)benzenesulfonyl chloride?
The InChIKey is WQVINRKETPSKIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl3F2O3S/c9-7-4(16-3-6(12)13)1-2-5(8(7)10)17(11,14)15/h1-2,6H,3H2.
What are the key properties of 2,3-dichloro-4-(2,2-difluoroethoxy)benzenesulfonyl chloride?
2,3-dichloro-4-(2,2-difluoroethoxy)benzenesulfonyl chloride has a molecular weight of 325.55 g/mol, XLogP of 3.56, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloro-4-(2,2-difluoroethoxy)benzenesulfonyl chloride is sourced from PubChem (CID 60922522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).