C12H13Cl3O3S — CID 43247030
2,3-dichloro-4-cyclohexyloxybenzenesulfonyl chloride (PubChem CID 43247030) has the molecular formula C12H13Cl3O3S and a molecular weight of 343.66 g/mol. Its IUPAC name is 2,3-dichloro-4-cyclohexyloxybenzenesulfonyl chloride.
| Compound Name | 2,3-dichloro-4-cyclohexyloxybenzenesulfonyl chloride |
|---|---|
| PubChem CID | 43247030 |
| Molecular Formula | C12H13Cl3O3S |
| Molecular Weight | 343.66 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 2,3-dichloro-4-cyclohexyloxybenzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc(OC2CCCCC2)c(Cl)c1Cl |
| InChI | InChI=1S/C12H13Cl3O3S/c13-11-9(18-8-4-2-1-3-5-8)6-7-10(12(11)14)19(15,16)17/h6-8H,1-5H2 |
| InChIKey | KJHUSZKPTOPAHO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.66 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |