C15H21ClO3S — CID 82934940
4-cycloheptyloxy-2,5-dimethylbenzenesulfonyl chloride (PubChem CID 82934940) has the molecular formula C15H21ClO3S and a molecular weight of 316.85 g/mol. Its IUPAC name is 4-cycloheptyloxy-2,5-dimethylbenzenesulfonyl chloride.
| Compound Name | 4-cycloheptyloxy-2,5-dimethylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 82934940 |
| Molecular Formula | C15H21ClO3S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-cycloheptyloxy-2,5-dimethylbenzenesulfonyl chloride |
| SMILES | Cc1cc(S(=O)(=O)Cl)c(C)cc1OC1CCCCCC1 |
| InChI | InChI=1S/C15H21ClO3S/c1-11-10-15(20(16,17)18)12(2)9-14(11)19-13-7-5-3-4-6-8-13/h9-10,13H,3-8H2,1-2H3 |
| InChIKey | IGEJBEKJTCMKOR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |