2,5-dimethyl-4-propoxybenzenesulfonyl chloride

C11H15ClO3S — CID 43134395

IUPAC2,5-dimethyl-4-propoxybenzenesulfonyl chloride
SMILESCCCOc1cc(C)c(S(=O)(=O)Cl)cc1C
InChIInChI=1S/C11H15ClO3S/c1-4-5-15-10-6-9(3)11(7-8(10)2)16(12,13)14/h6-7H,4-5H2,1-3H3
InChIKeyPRSIYBRGHYZNTG-UHFFFAOYSA-N
MW262.76 g/mol
LogP3.02
Rot. Bonds4

About 2,5-dimethyl-4-propoxybenzenesulfonyl chloride

2,5-dimethyl-4-propoxybenzenesulfonyl chloride (PubChem CID 43134395) has the molecular formula C11H15ClO3S and a molecular weight of 262.76 g/mol. Its IUPAC name is 2,5-dimethyl-4-propoxybenzenesulfonyl chloride.

Molecular Properties

Compound Name2,5-dimethyl-4-propoxybenzenesulfonyl chloride
PubChem CID43134395
Molecular FormulaC11H15ClO3S
Molecular Weight262.76 g/mol
Exact Mass262.04
IUPAC Name2,5-dimethyl-4-propoxybenzenesulfonyl chloride
SMILESCCCOc1cc(C)c(S(=O)(=O)Cl)cc1C
InChIInChI=1S/C11H15ClO3S/c1-4-5-15-10-6-9(3)11(7-8(10)2)16(12,13)14/h6-7H,4-5H2,1-3H3
InChIKeyPRSIYBRGHYZNTG-UHFFFAOYSA-N
XLogP3.02
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.76
LogP ≤ 53.02
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 2,5-dimethyl-4-propoxybenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dimethyl-4-propoxybenzenesulfonyl chloride?
The IUPAC name of 2,5-dimethyl-4-propoxybenzenesulfonyl chloride (CID 43134395) is 2,5-dimethyl-4-propoxybenzenesulfonyl chloride.
What is the SMILES notation for 2,5-dimethyl-4-propoxybenzenesulfonyl chloride?
The canonical SMILES for 2,5-dimethyl-4-propoxybenzenesulfonyl chloride is CCCOc1cc(C)c(S(=O)(=O)Cl)cc1C.
What is the InChIKey of 2,5-dimethyl-4-propoxybenzenesulfonyl chloride?
The InChIKey is PRSIYBRGHYZNTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClO3S/c1-4-5-15-10-6-9(3)11(7-8(10)2)16(12,13)14/h6-7H,4-5H2,1-3H3.
What are the key properties of 2,5-dimethyl-4-propoxybenzenesulfonyl chloride?
2,5-dimethyl-4-propoxybenzenesulfonyl chloride has a molecular weight of 262.76 g/mol, XLogP of 3.02, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-4-propoxybenzenesulfonyl chloride is sourced from PubChem (CID 43134395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).