C12H17ClO4S — CID 60925970
4-(3-methoxypropoxy)-2,5-dimethylbenzenesulfonyl chloride (PubChem CID 60925970) has the molecular formula C12H17ClO4S and a molecular weight of 292.78 g/mol. Its IUPAC name is 4-(3-methoxypropoxy)-2,5-dimethylbenzenesulfonyl chloride.
| Compound Name | 4-(3-methoxypropoxy)-2,5-dimethylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 60925970 |
| Molecular Formula | C12H17ClO4S |
| Molecular Weight | 292.78 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 4-(3-methoxypropoxy)-2,5-dimethylbenzenesulfonyl chloride |
| SMILES | COCCCOc1cc(C)c(S(=O)(=O)Cl)cc1C |
| InChI | InChI=1S/C12H17ClO4S/c1-9-8-12(18(13,14)15)10(2)7-11(9)17-6-4-5-16-3/h7-8H,4-6H2,1-3H3 |
| InChIKey | KTRPBKQBAGSFAE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.78 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|