C14H21ClO4S — CID 106451024
2,5-dimethyl-4-[2-(2-methylpropoxy)ethoxy]benzenesulfonyl chloride (PubChem CID 106451024) has the molecular formula C14H21ClO4S and a molecular weight of 320.84 g/mol. Its IUPAC name is 2,5-dimethyl-4-[2-(2-methylpropoxy)ethoxy]benzenesulfonyl chloride.
| Compound Name | 2,5-dimethyl-4-[2-(2-methylpropoxy)ethoxy]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 106451024 |
| Molecular Formula | C14H21ClO4S |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2,5-dimethyl-4-[2-(2-methylpropoxy)ethoxy]benzenesulfonyl chloride |
| SMILES | Cc1cc(S(=O)(=O)Cl)c(C)cc1OCCOCC(C)C |
| InChI | InChI=1S/C14H21ClO4S/c1-10(2)9-18-5-6-19-13-7-12(4)14(8-11(13)3)20(15,16)17/h7-8,10H,5-6,9H2,1-4H3 |
| InChIKey | JVKPMALEUTXKGE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|