C12H15BrClFO4S — CID 106451084
5-bromo-2-fluoro-4-[2-(2-methylpropoxy)ethoxy]benzenesulfonyl chloride (PubChem CID 106451084) has the molecular formula C12H15BrClFO4S and a molecular weight of 389.67 g/mol. Its IUPAC name is 5-bromo-2-fluoro-4-[2-(2-methylpropoxy)ethoxy]benzenesulfonyl chloride.
| Compound Name | 5-bromo-2-fluoro-4-[2-(2-methylpropoxy)ethoxy]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 106451084 |
| Molecular Formula | C12H15BrClFO4S |
| Molecular Weight | 389.67 g/mol |
| Exact Mass | 387.95 |
| IUPAC Name | 5-bromo-2-fluoro-4-[2-(2-methylpropoxy)ethoxy]benzenesulfonyl chloride |
| SMILES | CC(C)COCCOc1cc(F)c(S(=O)(=O)Cl)cc1Br |
| InChI | InChI=1S/C12H15BrClFO4S/c1-8(2)7-18-3-4-19-11-6-10(15)12(5-9(11)13)20(14,16)17/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | BBWURXUXUSPSEW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.67 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|