C10H11ClF2O3S — CID 82915058
3,5-difluoro-2-(2-methylpropoxy)benzenesulfonyl chloride (PubChem CID 82915058) has the molecular formula C10H11ClF2O3S and a molecular weight of 284.71 g/mol. Its IUPAC name is 3,5-difluoro-2-(2-methylpropoxy)benzenesulfonyl chloride.
| Compound Name | 3,5-difluoro-2-(2-methylpropoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 82915058 |
| Molecular Formula | C10H11ClF2O3S |
| Molecular Weight | 284.71 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 3,5-difluoro-2-(2-methylpropoxy)benzenesulfonyl chloride |
| SMILES | CC(C)COc1c(F)cc(F)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H11ClF2O3S/c1-6(2)5-16-10-8(13)3-7(12)4-9(10)17(11,14)15/h3-4,6H,5H2,1-2H3 |
| InChIKey | UWZJHZNVFNUMBP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.71 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |