C11H11ClF2O4S — CID 65397926
2-methylpropyl 5-chlorosulfonyl-2,4-difluorobenzoate (PubChem CID 65397926) has the molecular formula C11H11ClF2O4S and a molecular weight of 312.72 g/mol. Its IUPAC name is 2-methylpropyl 5-chlorosulfonyl-2,4-difluorobenzoate.
| Compound Name | 2-methylpropyl 5-chlorosulfonyl-2,4-difluorobenzoate |
|---|---|
| PubChem CID | 65397926 |
| Molecular Formula | C11H11ClF2O4S |
| Molecular Weight | 312.72 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 2-methylpropyl 5-chlorosulfonyl-2,4-difluorobenzoate |
| SMILES | CC(C)COC(=O)c1cc(S(=O)(=O)Cl)c(F)cc1F |
| InChI | InChI=1S/C11H11ClF2O4S/c1-6(2)5-18-11(15)7-3-10(19(12,16)17)9(14)4-8(7)13/h3-4,6H,5H2,1-2H3 |
| InChIKey | YLGOQVXNOBDDQL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.72 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |