C13H15Cl2FO4S — CID 66225109
3,3-dimethylbutyl 4-chloro-5-chlorosulfonyl-2-fluorobenzoate (PubChem CID 66225109) has the molecular formula C13H15Cl2FO4S and a molecular weight of 357.23 g/mol. Its IUPAC name is 3,3-dimethylbutyl 4-chloro-5-chlorosulfonyl-2-fluorobenzoate.
| Compound Name | 3,3-dimethylbutyl 4-chloro-5-chlorosulfonyl-2-fluorobenzoate |
|---|---|
| PubChem CID | 66225109 |
| Molecular Formula | C13H15Cl2FO4S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 3,3-dimethylbutyl 4-chloro-5-chlorosulfonyl-2-fluorobenzoate |
| SMILES | CC(C)(C)CCOC(=O)c1cc(S(=O)(=O)Cl)c(Cl)cc1F |
| InChI | InChI=1S/C13H15Cl2FO4S/c1-13(2,3)4-5-20-12(17)8-6-11(21(15,18)19)9(14)7-10(8)16/h6-7H,4-5H2,1-3H3 |
| InChIKey | NKJXKSICCOCJBJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |