About 2-cyclopropylethyl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate
2-cyclopropylethyl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate (PubChem CID 106206911) has the molecular formula C13H14ClFO4S
and a molecular weight of 320.77 g/mol. Its IUPAC name is 2-cyclopropylethyl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate.
Molecular Properties
| Compound Name | 2-cyclopropylethyl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate |
| PubChem CID | 106206911 |
| Molecular Formula | C13H14ClFO4S |
| Molecular Weight | 320.77 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 2-cyclopropylethyl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate |
| SMILES | Cc1cc(F)c(C(=O)OCCC2CC2)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C13H14ClFO4S/c1-8-6-11(15)10(7-12(8)20(14,17)18)13(16)19-5-4-9-2-3-9/h6-7,9H,2-5H2,1H3 |
| InChIKey | IOGPZDPBTCSWDG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.77 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopropylethyl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylethyl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate?
The IUPAC name of 2-cyclopropylethyl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate (CID 106206911) is 2-cyclopropylethyl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate.
What is the SMILES notation for 2-cyclopropylethyl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate?
The canonical SMILES for 2-cyclopropylethyl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate is Cc1cc(F)c(C(=O)OCCC2CC2)cc1S(=O)(=O)Cl.
What is the InChIKey of 2-cyclopropylethyl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate?
The InChIKey is IOGPZDPBTCSWDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClFO4S/c1-8-6-11(15)10(7-12(8)20(14,17)18)13(16)19-5-4-9-2-3-9/h6-7,9H,2-5H2,1H3.
What are the key properties of 2-cyclopropylethyl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate?
2-cyclopropylethyl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate has a molecular weight of 320.77 g/mol, XLogP of 3.02, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylethyl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate is sourced from PubChem (CID 106206911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).