C11H13ClO4S2 — CID 106206949
2-cyclopropylethyl 5-chlorosulfonyl-4-methylthiophene-3-carboxylate (PubChem CID 106206949) has the molecular formula C11H13ClO4S2 and a molecular weight of 308.81 g/mol. Its IUPAC name is 2-cyclopropylethyl 5-chlorosulfonyl-4-methylthiophene-3-carboxylate.
| Compound Name | 2-cyclopropylethyl 5-chlorosulfonyl-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 106206949 |
| Molecular Formula | C11H13ClO4S2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 2-cyclopropylethyl 5-chlorosulfonyl-4-methylthiophene-3-carboxylate |
| SMILES | Cc1c(C(=O)OCCC2CC2)csc1S(=O)(=O)Cl |
| InChI | InChI=1S/C11H13ClO4S2/c1-7-9(6-17-11(7)18(12,14)15)10(13)16-5-4-8-2-3-8/h6,8H,2-5H2,1H3 |
| InChIKey | RANILHRAYHGNOV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |