About (2-methylcyclohexyl) 5-chlorosulfonyl-4-methylthiophene-3-carboxylate
(2-methylcyclohexyl) 5-chlorosulfonyl-4-methylthiophene-3-carboxylate (PubChem CID 79807442) has the molecular formula C13H17ClO4S2
and a molecular weight of 336.86 g/mol. Its IUPAC name is (2-methylcyclohexyl) 5-chlorosulfonyl-4-methylthiophene-3-carboxylate.
Molecular Properties
| Compound Name | (2-methylcyclohexyl) 5-chlorosulfonyl-4-methylthiophene-3-carboxylate |
| PubChem CID | 79807442 |
| Molecular Formula | C13H17ClO4S2 |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | (2-methylcyclohexyl) 5-chlorosulfonyl-4-methylthiophene-3-carboxylate |
| SMILES | Cc1c(C(=O)OC2CCCCC2C)csc1S(=O)(=O)Cl |
| InChI | InChI=1S/C13H17ClO4S2/c1-8-5-3-4-6-11(8)18-12(15)10-7-19-13(9(10)2)20(14,16)17/h7-8,11H,3-6H2,1-2H3 |
| InChIKey | UUGRUTHEOKYXTG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-methylcyclohexyl) 5-chlorosulfonyl-4-methylthiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylcyclohexyl) 5-chlorosulfonyl-4-methylthiophene-3-carboxylate?
The IUPAC name of (2-methylcyclohexyl) 5-chlorosulfonyl-4-methylthiophene-3-carboxylate (CID 79807442) is (2-methylcyclohexyl) 5-chlorosulfonyl-4-methylthiophene-3-carboxylate.
What is the SMILES notation for (2-methylcyclohexyl) 5-chlorosulfonyl-4-methylthiophene-3-carboxylate?
The canonical SMILES for (2-methylcyclohexyl) 5-chlorosulfonyl-4-methylthiophene-3-carboxylate is Cc1c(C(=O)OC2CCCCC2C)csc1S(=O)(=O)Cl.
What is the InChIKey of (2-methylcyclohexyl) 5-chlorosulfonyl-4-methylthiophene-3-carboxylate?
The InChIKey is UUGRUTHEOKYXTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClO4S2/c1-8-5-3-4-6-11(8)18-12(15)10-7-19-13(9(10)2)20(14,16)17/h7-8,11H,3-6H2,1-2H3.
What are the key properties of (2-methylcyclohexyl) 5-chlorosulfonyl-4-methylthiophene-3-carboxylate?
(2-methylcyclohexyl) 5-chlorosulfonyl-4-methylthiophene-3-carboxylate has a molecular weight of 336.86 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclohexyl) 5-chlorosulfonyl-4-methylthiophene-3-carboxylate is sourced from PubChem (CID 79807442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).